C20H22ClO3P — CID 90240714
[chloro-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 90240714) has the molecular formula C20H22ClO3P and a molecular weight of 376.82 g/mol. Its IUPAC name is [chloro-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [chloro-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 90240714 |
| Molecular Formula | C20H22ClO3P |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | [chloro-(2,4,6-trimethylbenzoyl)phosphoryl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(Cl)C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C20H22ClO3P/c1-11-7-13(3)17(14(4)8-11)19(22)25(21,24)20(23)18-15(5)9-12(2)10-16(18)6/h7-10H,1-6H3 |
| InChIKey | NPWVMLLWGFMSMF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|