C24H25O6PS2 — CID 149399389
bis-(4-methylphenyl)sulfonylphosphoryl-(2,4,6-trimethylphenyl)methanone (PubChem CID 149399389) has the molecular formula C24H25O6PS2 and a molecular weight of 504.57 g/mol. Its IUPAC name is bis-(4-methylphenyl)sulfonylphosphoryl-(2,4,6-trimethylphenyl)methanone.
| Compound Name | bis-(4-methylphenyl)sulfonylphosphoryl-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 149399389 |
| Molecular Formula | C24H25O6PS2 |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | bis-(4-methylphenyl)sulfonylphosphoryl-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1ccc(S(=O)(=O)P(=O)(C(=O)c2c(C)cc(C)cc2C)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H25O6PS2/c1-16-6-10-21(11-7-16)32(27,28)31(26,33(29,30)22-12-8-17(2)9-13-22)24(25)23-19(4)14-18(3)15-20(23)5/h6-15H,1-5H3 |
| InChIKey | YPBXROQIOUHBFU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|