C16H25NO — CID 17168159
N-(3,3-dimethylbutan-2-yl)-2,4,6-trimethylbenzamide (PubChem CID 17168159) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-2,4,6-trimethylbenzamide.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-2,4,6-trimethylbenzamide |
|---|---|
| PubChem CID | 17168159 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-2,4,6-trimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)NC(C)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C16H25NO/c1-10-8-11(2)14(12(3)9-10)15(18)17-13(4)16(5,6)7/h8-9,13H,1-7H3,(H,17,18) |
| InChIKey | JNFSKMBJBQIWPA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |