C17H24N4O — CID 121176641
2,4,6-trimethyl-N-[3-methyl-1-(triazol-2-yl)butan-2-yl]benzamide (PubChem CID 121176641) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[3-methyl-1-(triazol-2-yl)butan-2-yl]benzamide.
| Compound Name | 2,4,6-trimethyl-N-[3-methyl-1-(triazol-2-yl)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 121176641 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 2,4,6-trimethyl-N-[3-methyl-1-(triazol-2-yl)butan-2-yl]benzamide |
| SMILES | Cc1cc(C)c(C(=O)NC(Cn2nccn2)C(C)C)c(C)c1 |
| InChI | InChI=1S/C17H24N4O/c1-11(2)15(10-21-18-6-7-19-21)20-17(22)16-13(4)8-12(3)9-14(16)5/h6-9,11,15H,10H2,1-5H3,(H,20,22) |
| InChIKey | XZRZVOGUTYSPDR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |