C38H51IN2O4 — CID 162402085
N-[(2S)-1-[3-[(2S)-3,3-dimethyl-2-[(2,4,6-trimethylbenzoyl)amino]butoxy]-2-iodophenoxy]-3,3-dimethylbutan-2-yl]-2,4,6-trimethylbenzamide (PubChem CID 162402085) has the molecular formula C38H51IN2O4 and a molecular weight of 726.74 g/mol. Its IUPAC name is N-[(2S)-1-[3-[(2S)-3,3-dimethyl-2-[(2,4,6-trimethylbenzoyl)amino]butoxy]-2-iodophenoxy]-3,3-dimethylbutan-2-yl]-2,4,6-trimethylbenzamide.
| Compound Name | N-[(2S)-1-[3-[(2S)-3,3-dimethyl-2-[(2,4,6-trimethylbenzoyl)amino]butoxy]-2-iodophenoxy]-3,3-dimethylbutan-2-yl]-2,4,6-trimethylbenzamide |
|---|---|
| PubChem CID | 162402085 |
| Molecular Formula | C38H51IN2O4 |
| Molecular Weight | 726.74 g/mol |
| Exact Mass | 726.29 |
| IUPAC Name | N-[(2S)-1-[3-[(2S)-3,3-dimethyl-2-[(2,4,6-trimethylbenzoyl)amino]butoxy]-2-iodophenoxy]-3,3-dimethylbutan-2-yl]-2,4,6-trimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)N[C@H](COc2cccc(OC[C@@H](NC(=O)c3c(C)cc(C)cc3C)C(C)(C)C)c2I)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C38H51IN2O4/c1-22-16-24(3)32(25(4)17-22)35(42)40-30(37(7,8)9)20-44-28-14-13-15-29(34(28)39)45-21-31(38(10,11)12)41-36(43)33-26(5)18-23(2)19-27(33)6/h13-19,30-31H,20-21H2,1-12H3,(H,40,42)(H,41,43)/t30-,31-/m1/s1 |
| InChIKey | GRGUDSUDMWBFTP-FIRIVFDPSA-N |
| XLogP | 8.59 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.74 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|