C42H43IN2O4 — CID 66546185
N-[(1S)-2-[2-iodo-3-[(2S)-2-phenyl-2-[(2,4,6-trimethylbenzoyl)amino]ethoxy]phenoxy]-1-phenylethyl]-2,4,6-trimethylbenzamide (PubChem CID 66546185) has the molecular formula C42H43IN2O4 and a molecular weight of 766.72 g/mol. Its IUPAC name is N-[(1S)-2-[2-iodo-3-[(2S)-2-phenyl-2-[(2,4,6-trimethylbenzoyl)amino]ethoxy]phenoxy]-1-phenylethyl]-2,4,6-trimethylbenzamide.
| Compound Name | N-[(1S)-2-[2-iodo-3-[(2S)-2-phenyl-2-[(2,4,6-trimethylbenzoyl)amino]ethoxy]phenoxy]-1-phenylethyl]-2,4,6-trimethylbenzamide |
|---|---|
| PubChem CID | 66546185 |
| Molecular Formula | C42H43IN2O4 |
| Molecular Weight | 766.72 g/mol |
| Exact Mass | 766.23 |
| IUPAC Name | N-[(1S)-2-[2-iodo-3-[(2S)-2-phenyl-2-[(2,4,6-trimethylbenzoyl)amino]ethoxy]phenoxy]-1-phenylethyl]-2,4,6-trimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)N[C@H](COc2cccc(OC[C@@H](NC(=O)c3c(C)cc(C)cc3C)c3ccccc3)c2I)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C42H43IN2O4/c1-26-20-28(3)38(29(4)21-26)41(46)44-34(32-14-9-7-10-15-32)24-48-36-18-13-19-37(40(36)43)49-25-35(33-16-11-8-12-17-33)45-42(47)39-30(5)22-27(2)23-31(39)6/h7-23,34-35H,24-25H2,1-6H3,(H,44,46)(H,45,47)/t34-,35-/m1/s1 |
| InChIKey | BWKBJZWDDXWEDR-VSJLXWSYSA-N |
| XLogP | 9.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.72 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|