C16H23NO2 — CID 104957100
N-[(1S,2S)-2-hydroxycyclohexyl]-2,4,6-trimethylbenzamide (PubChem CID 104957100) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-2,4,6-trimethylbenzamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2,4,6-trimethylbenzamide |
|---|---|
| PubChem CID | 104957100 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2,4,6-trimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)N[C@H]2CCCC[C@@H]2O)c(C)c1 |
| InChI | InChI=1S/C16H23NO2/c1-10-8-11(2)15(12(3)9-10)16(19)17-13-6-4-5-7-14(13)18/h8-9,13-14,18H,4-7H2,1-3H3,(H,17,19)/t13-,14-/m0/s1 |
| InChIKey | JBPRLFOTTIHIAT-KBPBESRZSA-N |
| XLogP | 2.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |