C23H27O3P — CID 59218771
[oxiran-2-ylmethyl-(2,4,6-trimethylbenzoyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 59218771) has the molecular formula C23H27O3P and a molecular weight of 382.44 g/mol. Its IUPAC name is [oxiran-2-ylmethyl-(2,4,6-trimethylbenzoyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [oxiran-2-ylmethyl-(2,4,6-trimethylbenzoyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 59218771 |
| Molecular Formula | C23H27O3P |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | [oxiran-2-ylmethyl-(2,4,6-trimethylbenzoyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P(CC2CO2)C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C23H27O3P/c1-13-7-15(3)20(16(4)8-13)22(24)27(12-19-11-26-19)23(25)21-17(5)9-14(2)10-18(21)6/h7-10,19H,11-12H2,1-6H3 |
| InChIKey | DNHDIUGQFMKPLG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|