C26H31Cl2O3P — CID 22183971
(4-tert-butyl-2,6-dimethylphenyl)-[cyclohexyl-(2,6-dichlorobenzoyl)phosphoryl]methanone (PubChem CID 22183971) has the molecular formula C26H31Cl2O3P and a molecular weight of 493.41 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)-[cyclohexyl-(2,6-dichlorobenzoyl)phosphoryl]methanone.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)-[cyclohexyl-(2,6-dichlorobenzoyl)phosphoryl]methanone |
|---|---|
| PubChem CID | 22183971 |
| Molecular Formula | C26H31Cl2O3P |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)-[cyclohexyl-(2,6-dichlorobenzoyl)phosphoryl]methanone |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(=O)P(=O)(C(=O)c1c(Cl)cccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C26H31Cl2O3P/c1-16-14-18(26(3,4)5)15-17(2)22(16)24(29)32(31,19-10-7-6-8-11-19)25(30)23-20(27)12-9-13-21(23)28/h9,12-15,19H,6-8,10-11H2,1-5H3 |
| InChIKey | TZFXIADXWLJZOM-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|