C23H14ClF6O3P — CID 18513882
[[2,6-bis(trifluoromethyl)benzoyl]-phenylphosphoryl]-(2-chloro-6-methylphenyl)methanone (PubChem CID 18513882) has the molecular formula C23H14ClF6O3P and a molecular weight of 518.78 g/mol. Its IUPAC name is [[2,6-bis(trifluoromethyl)benzoyl]-phenylphosphoryl]-(2-chloro-6-methylphenyl)methanone.
| Compound Name | [[2,6-bis(trifluoromethyl)benzoyl]-phenylphosphoryl]-(2-chloro-6-methylphenyl)methanone |
|---|---|
| PubChem CID | 18513882 |
| Molecular Formula | C23H14ClF6O3P |
| Molecular Weight | 518.78 g/mol |
| Exact Mass | 518.03 |
| IUPAC Name | [[2,6-bis(trifluoromethyl)benzoyl]-phenylphosphoryl]-(2-chloro-6-methylphenyl)methanone |
| SMILES | Cc1cccc(Cl)c1C(=O)P(=O)(C(=O)c1c(C(F)(F)F)cccc1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C23H14ClF6O3P/c1-13-7-5-12-17(24)18(13)20(31)34(33,14-8-3-2-4-9-14)21(32)19-15(22(25,26)27)10-6-11-16(19)23(28,29)30/h2-12H,1H3 |
| InChIKey | UYZPATHZMUXXQJ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.78 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|