C22H15F6O2P — CID 18514169
[benzyl(phenyl)phosphoryl]-[2,6-bis(trifluoromethyl)phenyl]methanone (PubChem CID 18514169) has the molecular formula C22H15F6O2P and a molecular weight of 456.32 g/mol. Its IUPAC name is [benzyl(phenyl)phosphoryl]-[2,6-bis(trifluoromethyl)phenyl]methanone.
| Compound Name | [benzyl(phenyl)phosphoryl]-[2,6-bis(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 18514169 |
| Molecular Formula | C22H15F6O2P |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | [benzyl(phenyl)phosphoryl]-[2,6-bis(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1c(C(F)(F)F)cccc1C(F)(F)F)P(=O)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H15F6O2P/c23-21(24,25)17-12-7-13-18(22(26,27)28)19(17)20(29)31(30,16-10-5-2-6-11-16)14-15-8-3-1-4-9-15/h1-13H,14H2 |
| InChIKey | QNHDKUGHPQAHRT-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|