C22H10Cl3F6O3P — CID 18514074
[2,6-bis(trifluoromethyl)phenyl]-[phenyl-(2,3,6-trichlorobenzoyl)phosphoryl]methanone (PubChem CID 18514074) has the molecular formula C22H10Cl3F6O3P and a molecular weight of 573.64 g/mol. Its IUPAC name is [2,6-bis(trifluoromethyl)phenyl]-[phenyl-(2,3,6-trichlorobenzoyl)phosphoryl]methanone.
| Compound Name | [2,6-bis(trifluoromethyl)phenyl]-[phenyl-(2,3,6-trichlorobenzoyl)phosphoryl]methanone |
|---|---|
| PubChem CID | 18514074 |
| Molecular Formula | C22H10Cl3F6O3P |
| Molecular Weight | 573.64 g/mol |
| Exact Mass | 571.93 |
| IUPAC Name | [2,6-bis(trifluoromethyl)phenyl]-[phenyl-(2,3,6-trichlorobenzoyl)phosphoryl]methanone |
| SMILES | O=C(c1c(C(F)(F)F)cccc1C(F)(F)F)P(=O)(C(=O)c1c(Cl)ccc(Cl)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C22H10Cl3F6O3P/c23-14-9-10-15(24)18(25)17(14)20(33)35(34,11-5-2-1-3-6-11)19(32)16-12(21(26,27)28)7-4-8-13(16)22(29,30)31/h1-10H |
| InChIKey | GTQDLCUNSPWTJD-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.64 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|