C26H21F6O3P — CID 18513915
[[2,6-bis(trifluoromethyl)benzoyl]-phenylphosphoryl]-(2,6-diethylphenyl)methanone (PubChem CID 18513915) has the molecular formula C26H21F6O3P and a molecular weight of 526.41 g/mol. Its IUPAC name is [[2,6-bis(trifluoromethyl)benzoyl]-phenylphosphoryl]-(2,6-diethylphenyl)methanone.
| Compound Name | [[2,6-bis(trifluoromethyl)benzoyl]-phenylphosphoryl]-(2,6-diethylphenyl)methanone |
|---|---|
| PubChem CID | 18513915 |
| Molecular Formula | C26H21F6O3P |
| Molecular Weight | 526.41 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | [[2,6-bis(trifluoromethyl)benzoyl]-phenylphosphoryl]-(2,6-diethylphenyl)methanone |
| SMILES | CCc1cccc(CC)c1C(=O)P(=O)(C(=O)c1c(C(F)(F)F)cccc1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C26H21F6O3P/c1-3-16-10-8-11-17(4-2)21(16)23(33)36(35,18-12-6-5-7-13-18)24(34)22-19(25(27,28)29)14-9-15-20(22)26(30,31)32/h5-15H,3-4H2,1-2H3 |
| InChIKey | PFFGWWBTFVVRAT-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.41 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|