C28H26Cl2F6O3 — CID 20590791
8,8-bis[3-chloro-5-(2,2-difluoropropanoyl)-4-methylphenyl]-2,2-difluorooct-7-en-3-one (PubChem CID 20590791) has the molecular formula C28H26Cl2F6O3 and a molecular weight of 595.41 g/mol. Its IUPAC name is 8,8-bis[3-chloro-5-(2,2-difluoropropanoyl)-4-methylphenyl]-2,2-difluorooct-7-en-3-one.
| Compound Name | 8,8-bis[3-chloro-5-(2,2-difluoropropanoyl)-4-methylphenyl]-2,2-difluorooct-7-en-3-one |
|---|---|
| PubChem CID | 20590791 |
| Molecular Formula | C28H26Cl2F6O3 |
| Molecular Weight | 595.41 g/mol |
| Exact Mass | 594.12 |
| IUPAC Name | 8,8-bis[3-chloro-5-(2,2-difluoropropanoyl)-4-methylphenyl]-2,2-difluorooct-7-en-3-one |
| SMILES | Cc1c(Cl)cc(C(=CCCCC(=O)C(C)(F)F)c2cc(Cl)c(C)c(C(=O)C(C)(F)F)c2)cc1C(=O)C(C)(F)F |
| InChI | InChI=1S/C28H26Cl2F6O3/c1-14-19(24(38)27(4,33)34)10-16(12-21(14)29)18(8-6-7-9-23(37)26(3,31)32)17-11-20(15(2)22(30)13-17)25(39)28(5,35)36/h8,10-13H,6-7,9H2,1-5H3 |
| InChIKey | SICCSVJOBDCMEG-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.41 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|