C24H19Cl4O3P — CID 71434765
[(2-butylphenyl)-(2,6-dichlorobenzoyl)phosphoryl]-(2,6-dichlorophenyl)methanone (PubChem CID 71434765) has the molecular formula C24H19Cl4O3P and a molecular weight of 528.20 g/mol. Its IUPAC name is [(2-butylphenyl)-(2,6-dichlorobenzoyl)phosphoryl]-(2,6-dichlorophenyl)methanone.
| Compound Name | [(2-butylphenyl)-(2,6-dichlorobenzoyl)phosphoryl]-(2,6-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 71434765 |
| Molecular Formula | C24H19Cl4O3P |
| Molecular Weight | 528.20 g/mol |
| Exact Mass | 525.98 |
| IUPAC Name | [(2-butylphenyl)-(2,6-dichlorobenzoyl)phosphoryl]-(2,6-dichlorophenyl)methanone |
| SMILES | CCCCc1ccccc1P(=O)(C(=O)c1c(Cl)cccc1Cl)C(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H19Cl4O3P/c1-2-3-8-15-9-4-5-14-20(15)32(31,23(29)21-16(25)10-6-11-17(21)26)24(30)22-18(27)12-7-13-19(22)28/h4-7,9-14H,2-3,8H2,1H3 |
| InChIKey | CSKDCPLUTPDYBN-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.20 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|