C17H16Cl2O — CID 43160097
(4-butylphenyl)-(2,6-dichlorophenyl)methanone (PubChem CID 43160097) has the molecular formula C17H16Cl2O and a molecular weight of 307.22 g/mol. Its IUPAC name is (4-butylphenyl)-(2,6-dichlorophenyl)methanone.
| Compound Name | (4-butylphenyl)-(2,6-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 43160097 |
| Molecular Formula | C17H16Cl2O |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | (4-butylphenyl)-(2,6-dichlorophenyl)methanone |
| SMILES | CCCCc1ccc(C(=O)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C17H16Cl2O/c1-2-3-5-12-8-10-13(11-9-12)17(20)16-14(18)6-4-7-15(16)19/h4,6-11H,2-3,5H2,1H3 |
| InChIKey | CRAWFYHMBCDCGL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |