C17H14Cl4O4P2 — CID 139438356
[(2,6-dichlorobenzoyl)-propylphosphoryl]-(2,6-dichlorophenyl)methanone;oxophosphane (PubChem CID 139438356) has the molecular formula C17H14Cl4O4P2 and a molecular weight of 486.06 g/mol. Its IUPAC name is [(2,6-dichlorobenzoyl)-propylphosphoryl]-(2,6-dichlorophenyl)methanone;oxophosphane.
| Compound Name | [(2,6-dichlorobenzoyl)-propylphosphoryl]-(2,6-dichlorophenyl)methanone;oxophosphane |
|---|---|
| PubChem CID | 139438356 |
| Molecular Formula | C17H14Cl4O4P2 |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 483.91 |
| IUPAC Name | [(2,6-dichlorobenzoyl)-propylphosphoryl]-(2,6-dichlorophenyl)methanone;oxophosphane |
| SMILES | CCCP(=O)(C(=O)c1c(Cl)cccc1Cl)C(=O)c1c(Cl)cccc1Cl.O=P |
| InChI | InChI=1S/C17H13Cl4O3P.HOP/c1-2-9-25(24,16(22)14-10(18)5-3-6-11(14)19)17(23)15-12(20)7-4-8-13(15)21;1-2/h3-8H,2,9H2,1H3;2H |
| InChIKey | CZWZHXJZCFQGDN-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|