C20H10Cl5O3P — CID 19849616
[(4-chlorophenyl)-(2,6-dichlorobenzoyl)phosphoryl]-(2,6-dichlorophenyl)methanone (PubChem CID 19849616) has the molecular formula C20H10Cl5O3P and a molecular weight of 506.54 g/mol. Its IUPAC name is [(4-chlorophenyl)-(2,6-dichlorobenzoyl)phosphoryl]-(2,6-dichlorophenyl)methanone.
| Compound Name | [(4-chlorophenyl)-(2,6-dichlorobenzoyl)phosphoryl]-(2,6-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 19849616 |
| Molecular Formula | C20H10Cl5O3P |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 503.88 |
| IUPAC Name | [(4-chlorophenyl)-(2,6-dichlorobenzoyl)phosphoryl]-(2,6-dichlorophenyl)methanone |
| SMILES | O=C(c1c(Cl)cccc1Cl)P(=O)(C(=O)c1c(Cl)cccc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H10Cl5O3P/c21-11-7-9-12(10-8-11)29(28,19(26)17-13(22)3-1-4-14(17)23)20(27)18-15(24)5-2-6-16(18)25/h1-10H |
| InChIKey | VSCYSXBQCDNELJ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|