About azane;1-butyl-2-chlorobenzene
azane;1-butyl-2-chlorobenzene (PubChem CID 19011342) has the molecular formula C10H16ClN
and a molecular weight of 185.70 g/mol. Its IUPAC name is azane;1-butyl-2-chlorobenzene.
Molecular Properties
| Compound Name | azane;1-butyl-2-chlorobenzene |
| PubChem CID | 19011342 |
| Molecular Formula | C10H16ClN |
| Molecular Weight | 185.70 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | azane;1-butyl-2-chlorobenzene |
| SMILES | CCCCc1ccccc1Cl.N |
| InChI | InChI=1S/C10H13Cl.H3N/c1-2-3-6-9-7-4-5-8-10(9)11;/h4-5,7-8H,2-3,6H2,1H3;1H3 |
| InChIKey | FYJKPCNAXSDCHW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.70 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;1-butyl-2-chlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-butyl-2-chlorobenzene?
The IUPAC name of azane;1-butyl-2-chlorobenzene (CID 19011342) is azane;1-butyl-2-chlorobenzene.
What is the SMILES notation for azane;1-butyl-2-chlorobenzene?
The canonical SMILES for azane;1-butyl-2-chlorobenzene is CCCCc1ccccc1Cl.N.
What is the InChIKey of azane;1-butyl-2-chlorobenzene?
The InChIKey is FYJKPCNAXSDCHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Cl.H3N/c1-2-3-6-9-7-4-5-8-10(9)11;/h4-5,7-8H,2-3,6H2,1H3;1H3.
What are the key properties of azane;1-butyl-2-chlorobenzene?
azane;1-butyl-2-chlorobenzene has a molecular weight of 185.70 g/mol, XLogP of 3.84, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-butyl-2-chlorobenzene is sourced from PubChem (CID 19011342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).