C23H29O6P — CID 22183560
[butan-2-yl-(2,4,6-trimethoxybenzoyl)phosphoryl]-(2,6-dimethylphenyl)methanone (PubChem CID 22183560) has the molecular formula C23H29O6P and a molecular weight of 432.45 g/mol. Its IUPAC name is [butan-2-yl-(2,4,6-trimethoxybenzoyl)phosphoryl]-(2,6-dimethylphenyl)methanone.
| Compound Name | [butan-2-yl-(2,4,6-trimethoxybenzoyl)phosphoryl]-(2,6-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 22183560 |
| Molecular Formula | C23H29O6P |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [butan-2-yl-(2,4,6-trimethoxybenzoyl)phosphoryl]-(2,6-dimethylphenyl)methanone |
| SMILES | CCC(C)P(=O)(C(=O)c1c(C)cccc1C)C(=O)c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C23H29O6P/c1-8-16(4)30(26,22(24)20-14(2)10-9-11-15(20)3)23(25)21-18(28-6)12-17(27-5)13-19(21)29-7/h9-13,16H,8H2,1-7H3 |
| InChIKey | GSCHJEYVKVUJAB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|