C50H63O5P — CID 139816196
2-bis(2,6-diethylbenzoyl)phosphoryl-1,3-bis(2,6-diethylphenyl)-2-pentylpropane-1,3-dione (PubChem CID 139816196) has the molecular formula C50H63O5P and a molecular weight of 775.02 g/mol. Its IUPAC name is 2-bis(2,6-diethylbenzoyl)phosphoryl-1,3-bis(2,6-diethylphenyl)-2-pentylpropane-1,3-dione.
| Compound Name | 2-bis(2,6-diethylbenzoyl)phosphoryl-1,3-bis(2,6-diethylphenyl)-2-pentylpropane-1,3-dione |
|---|---|
| PubChem CID | 139816196 |
| Molecular Formula | C50H63O5P |
| Molecular Weight | 775.02 g/mol |
| Exact Mass | 774.44 |
| IUPAC Name | 2-bis(2,6-diethylbenzoyl)phosphoryl-1,3-bis(2,6-diethylphenyl)-2-pentylpropane-1,3-dione |
| SMILES | CCCCCC(C(=O)c1c(CC)cccc1CC)(C(=O)c1c(CC)cccc1CC)P(=O)(C(=O)c1c(CC)cccc1CC)C(=O)c1c(CC)cccc1CC |
| InChI | InChI=1S/C50H63O5P/c1-10-19-20-33-50(46(51)42-34(11-2)25-21-26-35(42)12-3,47(52)43-36(13-4)27-22-28-37(43)14-5)56(55,48(53)44-38(15-6)29-23-30-39(44)16-7)49(54)45-40(17-8)31-24-32-41(45)18-9/h21-32H,10-20,33H2,1-9H3 |
| InChIKey | YQCDNAAIEHFBIO-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.02 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|