C36H54N4O6 — CID 101307074
2-ethyl-2-heptyl-1-N',3-N'-bis(2-hydroxy-6-pentylbenzoyl)propanedihydrazide (PubChem CID 101307074) has the molecular formula C36H54N4O6 and a molecular weight of 638.85 g/mol. Its IUPAC name is 2-ethyl-2-heptyl-1-N',3-N'-bis(2-hydroxy-6-pentylbenzoyl)propanedihydrazide.
| Compound Name | 2-ethyl-2-heptyl-1-N',3-N'-bis(2-hydroxy-6-pentylbenzoyl)propanedihydrazide |
|---|---|
| PubChem CID | 101307074 |
| Molecular Formula | C36H54N4O6 |
| Molecular Weight | 638.85 g/mol |
| Exact Mass | 638.40 |
| IUPAC Name | 2-ethyl-2-heptyl-1-N',3-N'-bis(2-hydroxy-6-pentylbenzoyl)propanedihydrazide |
| SMILES | CCCCCCCC(CC)(C(=O)NNC(=O)c1c(O)cccc1CCCCC)C(=O)NNC(=O)c1c(O)cccc1CCCCC |
| InChI | InChI=1S/C36H54N4O6/c1-5-9-12-13-16-25-36(8-4,34(45)39-37-32(43)30-26(19-14-10-6-2)21-17-23-28(30)41)35(46)40-38-33(44)31-27(20-15-11-7-3)22-18-24-29(31)42/h17-18,21-24,41-42H,5-16,19-20,25H2,1-4H3,(H,37,43)(H,38,44)(H,39,45)(H,40,46) |
| InChIKey | TZTLRMTZIISKAJ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.85 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|