C34H50N4O6 — CID 101306069
1-N',8-N'-bis(2-butyl-6-hydroxybenzoyl)-2-methyl-7-propyloctanedihydrazide (PubChem CID 101306069) has the molecular formula C34H50N4O6 and a molecular weight of 610.80 g/mol. Its IUPAC name is 1-N',8-N'-bis(2-butyl-6-hydroxybenzoyl)-2-methyl-7-propyloctanedihydrazide.
| Compound Name | 1-N',8-N'-bis(2-butyl-6-hydroxybenzoyl)-2-methyl-7-propyloctanedihydrazide |
|---|---|
| PubChem CID | 101306069 |
| Molecular Formula | C34H50N4O6 |
| Molecular Weight | 610.80 g/mol |
| Exact Mass | 610.37 |
| IUPAC Name | 1-N',8-N'-bis(2-butyl-6-hydroxybenzoyl)-2-methyl-7-propyloctanedihydrazide |
| SMILES | CCCCc1cccc(O)c1C(=O)NNC(=O)C(C)CCCCC(CCC)C(=O)NNC(=O)c1c(O)cccc1CCCC |
| InChI | InChI=1S/C34H50N4O6/c1-5-8-16-24-19-12-21-27(39)29(24)33(43)37-35-31(41)23(4)15-10-11-18-26(14-7-3)32(42)36-38-34(44)30-25(17-9-6-2)20-13-22-28(30)40/h12-13,19-23,26,39-40H,5-11,14-18H2,1-4H3,(H,35,41)(H,36,42)(H,37,43)(H,38,44) |
| InChIKey | ZDKAXRGQAJZQDQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.80 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|