C38H58N4O6 — CID 101307139
1-N',9-N'-bis(3-hexyl-2-hydroxybenzoyl)-2-propylnonanedihydrazide (PubChem CID 101307139) has the molecular formula C38H58N4O6 and a molecular weight of 666.90 g/mol. Its IUPAC name is 1-N',9-N'-bis(3-hexyl-2-hydroxybenzoyl)-2-propylnonanedihydrazide.
| Compound Name | 1-N',9-N'-bis(3-hexyl-2-hydroxybenzoyl)-2-propylnonanedihydrazide |
|---|---|
| PubChem CID | 101307139 |
| Molecular Formula | C38H58N4O6 |
| Molecular Weight | 666.90 g/mol |
| Exact Mass | 666.44 |
| IUPAC Name | 1-N',9-N'-bis(3-hexyl-2-hydroxybenzoyl)-2-propylnonanedihydrazide |
| SMILES | CCCCCCc1cccc(C(=O)NNC(=O)CCCCCCC(CCC)C(=O)NNC(=O)c2cccc(CCCCCC)c2O)c1O |
| InChI | InChI=1S/C38H58N4O6/c1-4-7-9-13-20-28-23-17-25-31(34(28)44)37(47)41-39-33(43)27-16-12-11-15-22-30(19-6-3)36(46)40-42-38(48)32-26-18-24-29(35(32)45)21-14-10-8-5-2/h17-18,23-26,30,44-45H,4-16,19-22,27H2,1-3H3,(H,39,43)(H,40,46)(H,41,47)(H,42,48) |
| InChIKey | HKXNTOWFJFKPTC-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.90 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|