C40H62N4O6 — CID 101307249
1-N',7-N'-bis(5-heptyl-2-hydroxybenzoyl)-2-pentylheptanedihydrazide (PubChem CID 101307249) has the molecular formula C40H62N4O6 and a molecular weight of 694.96 g/mol. Its IUPAC name is 1-N',7-N'-bis(5-heptyl-2-hydroxybenzoyl)-2-pentylheptanedihydrazide.
| Compound Name | 1-N',7-N'-bis(5-heptyl-2-hydroxybenzoyl)-2-pentylheptanedihydrazide |
|---|---|
| PubChem CID | 101307249 |
| Molecular Formula | C40H62N4O6 |
| Molecular Weight | 694.96 g/mol |
| Exact Mass | 694.47 |
| IUPAC Name | 1-N',7-N'-bis(5-heptyl-2-hydroxybenzoyl)-2-pentylheptanedihydrazide |
| SMILES | CCCCCCCc1ccc(O)c(C(=O)NNC(=O)CCCCC(CCCCC)C(=O)NNC(=O)c2cc(CCCCCCC)ccc2O)c1 |
| InChI | InChI=1S/C40H62N4O6/c1-4-7-10-12-15-19-30-24-26-35(45)33(28-30)39(49)43-41-37(47)23-18-17-22-32(21-14-9-6-3)38(48)42-44-40(50)34-29-31(25-27-36(34)46)20-16-13-11-8-5-2/h24-29,32,45-46H,4-23H2,1-3H3,(H,41,47)(H,42,48)(H,43,49)(H,44,50) |
| InChIKey | OJFGQCJGQUHYRF-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.96 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|