C42H66N4O6 — CID 101307423
2-ethyl-1-N',5-N'-bis(2-hydroxy-3-octylbenzoyl)-4-pentylpentanedihydrazide (PubChem CID 101307423) has the molecular formula C42H66N4O6 and a molecular weight of 723.01 g/mol. Its IUPAC name is 2-ethyl-1-N',5-N'-bis(2-hydroxy-3-octylbenzoyl)-4-pentylpentanedihydrazide.
| Compound Name | 2-ethyl-1-N',5-N'-bis(2-hydroxy-3-octylbenzoyl)-4-pentylpentanedihydrazide |
|---|---|
| PubChem CID | 101307423 |
| Molecular Formula | C42H66N4O6 |
| Molecular Weight | 723.01 g/mol |
| Exact Mass | 722.50 |
| IUPAC Name | 2-ethyl-1-N',5-N'-bis(2-hydroxy-3-octylbenzoyl)-4-pentylpentanedihydrazide |
| SMILES | CCCCCCCCc1cccc(C(=O)NNC(=O)C(CC)CC(CCCCC)C(=O)NNC(=O)c2cccc(CCCCCCCC)c2O)c1O |
| InChI | InChI=1S/C42H66N4O6/c1-5-9-12-14-16-19-23-32-26-21-28-35(37(32)47)41(51)45-43-39(49)31(8-4)30-34(25-18-11-7-3)40(50)44-46-42(52)36-29-22-27-33(38(36)48)24-20-17-15-13-10-6-2/h21-22,26-29,31,34,47-48H,5-20,23-25,30H2,1-4H3,(H,43,49)(H,44,50)(H,45,51)(H,46,52) |
| InChIKey | KLBMAXUHMLWTAH-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.01 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|