C26H37O2P — CID 18514166
(4-tert-butyl-2,6-dimethylphenyl)-[heptyl(phenyl)phosphoryl]methanone (PubChem CID 18514166) has the molecular formula C26H37O2P and a molecular weight of 412.55 g/mol. Its IUPAC name is (4-tert-butyl-2,6-dimethylphenyl)-[heptyl(phenyl)phosphoryl]methanone.
| Compound Name | (4-tert-butyl-2,6-dimethylphenyl)-[heptyl(phenyl)phosphoryl]methanone |
|---|---|
| PubChem CID | 18514166 |
| Molecular Formula | C26H37O2P |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | (4-tert-butyl-2,6-dimethylphenyl)-[heptyl(phenyl)phosphoryl]methanone |
| SMILES | CCCCCCCP(=O)(C(=O)c1c(C)cc(C(C)(C)C)cc1C)c1ccccc1 |
| InChI | InChI=1S/C26H37O2P/c1-7-8-9-10-14-17-29(28,23-15-12-11-13-16-23)25(27)24-20(2)18-22(19-21(24)3)26(4,5)6/h11-13,15-16,18-19H,7-10,14,17H2,1-6H3 |
| InChIKey | KMJSAWYPRUHQAR-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|