C27H37O4P — CID 151452968
3-methylbutyl 3-[(4-tert-butyl-2,6-dimethylbenzoyl)-phenylphosphoryl]propanoate (PubChem CID 151452968) has the molecular formula C27H37O4P and a molecular weight of 456.56 g/mol. Its IUPAC name is 3-methylbutyl 3-[(4-tert-butyl-2,6-dimethylbenzoyl)-phenylphosphoryl]propanoate.
| Compound Name | 3-methylbutyl 3-[(4-tert-butyl-2,6-dimethylbenzoyl)-phenylphosphoryl]propanoate |
|---|---|
| PubChem CID | 151452968 |
| Molecular Formula | C27H37O4P |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 3-methylbutyl 3-[(4-tert-butyl-2,6-dimethylbenzoyl)-phenylphosphoryl]propanoate |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(=O)P(=O)(CCC(=O)OCCC(C)C)c1ccccc1 |
| InChI | InChI=1S/C27H37O4P/c1-19(2)13-15-31-24(28)14-16-32(30,23-11-9-8-10-12-23)26(29)25-20(3)17-22(18-21(25)4)27(5,6)7/h8-12,17-19H,13-16H2,1-7H3 |
| InChIKey | PGWIJKQMGOCQQV-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|