C22H23Cl4O2P — CID 134205727
[(2,6-dichlorobenzoyl)-(2,4,4-trimethylpentyl)phosphanyl]-(2,6-dichlorophenyl)methanone (PubChem CID 134205727) has the molecular formula C22H23Cl4O2P and a molecular weight of 492.21 g/mol. Its IUPAC name is [(2,6-dichlorobenzoyl)-(2,4,4-trimethylpentyl)phosphanyl]-(2,6-dichlorophenyl)methanone.
| Compound Name | [(2,6-dichlorobenzoyl)-(2,4,4-trimethylpentyl)phosphanyl]-(2,6-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 134205727 |
| Molecular Formula | C22H23Cl4O2P |
| Molecular Weight | 492.21 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | [(2,6-dichlorobenzoyl)-(2,4,4-trimethylpentyl)phosphanyl]-(2,6-dichlorophenyl)methanone |
| SMILES | CC(CP(C(=O)c1c(Cl)cccc1Cl)C(=O)c1c(Cl)cccc1Cl)CC(C)(C)C |
| InChI | InChI=1S/C22H23Cl4O2P/c1-13(11-22(2,3)4)12-29(20(27)18-14(23)7-5-8-15(18)24)21(28)19-16(25)9-6-10-17(19)26/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | BPHPHQVCFNSIPI-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.21 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|