C24H38O4 — CID 73426539
[3-(3,5,5-trimethylhexanoyloxy)phenyl] 3,5,5-trimethylhexanoate (PubChem CID 73426539) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is [3-(3,5,5-trimethylhexanoyloxy)phenyl] 3,5,5-trimethylhexanoate.
| Compound Name | [3-(3,5,5-trimethylhexanoyloxy)phenyl] 3,5,5-trimethylhexanoate |
|---|---|
| PubChem CID | 73426539 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | [3-(3,5,5-trimethylhexanoyloxy)phenyl] 3,5,5-trimethylhexanoate |
| SMILES | CC(CC(=O)Oc1cccc(OC(=O)CC(C)CC(C)(C)C)c1)CC(C)(C)C |
| InChI | InChI=1S/C24H38O4/c1-17(15-23(3,4)5)12-21(25)27-19-10-9-11-20(14-19)28-22(26)13-18(2)16-24(6,7)8/h9-11,14,17-18H,12-13,15-16H2,1-8H3 |
| InChIKey | DKZWUEAPENCEEQ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|