C25H30N2O2 — CID 42728168
[1-(3-methylphenyl)-3-phenylpyrazol-5-yl] 3,5,5-trimethylhexanoate (PubChem CID 42728168) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is [1-(3-methylphenyl)-3-phenylpyrazol-5-yl] 3,5,5-trimethylhexanoate.
| Compound Name | [1-(3-methylphenyl)-3-phenylpyrazol-5-yl] 3,5,5-trimethylhexanoate |
|---|---|
| PubChem CID | 42728168 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | [1-(3-methylphenyl)-3-phenylpyrazol-5-yl] 3,5,5-trimethylhexanoate |
| SMILES | Cc1cccc(-n2nc(-c3ccccc3)cc2OC(=O)CC(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C25H30N2O2/c1-18-10-9-13-21(14-18)27-23(16-22(26-27)20-11-7-6-8-12-20)29-24(28)15-19(2)17-25(3,4)5/h6-14,16,19H,15,17H2,1-5H3 |
| InChIKey | ADOJEZUBXVUNGL-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |