C21H29N3O4 — CID 42726829
[1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 3,5,5-trimethylhexanoate (PubChem CID 42726829) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is [1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 3,5,5-trimethylhexanoate.
| Compound Name | [1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 3,5,5-trimethylhexanoate |
|---|---|
| PubChem CID | 42726829 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | [1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 3,5,5-trimethylhexanoate |
| SMILES | CC(CC(=O)Oc1cc(C(C)C)nn1-c1ccc([N+](=O)[O-])cc1)CC(C)(C)C |
| InChI | InChI=1S/C21H29N3O4/c1-14(2)18-12-19(28-20(25)11-15(3)13-21(4,5)6)23(22-18)16-7-9-17(10-8-16)24(26)27/h7-10,12,14-15H,11,13H2,1-6H3 |
| InChIKey | ORQIQMUQOLQMPR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|