C20H19N5O5 — CID 42730471
N-[3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-yl]-4-nitrobenzamide (PubChem CID 42730471) has the molecular formula C20H19N5O5 and a molecular weight of 409.40 g/mol. Its IUPAC name is N-[3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-yl]-4-nitrobenzamide.
| Compound Name | N-[3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 42730471 |
| Molecular Formula | C20H19N5O5 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-yl]-4-nitrobenzamide |
| SMILES | CC(C)(C)c1cc(NC(=O)c2ccc([N+](=O)[O-])cc2)n(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C20H19N5O5/c1-20(2,3)17-12-18(21-19(26)13-4-6-15(7-5-13)24(27)28)23(22-17)14-8-10-16(11-9-14)25(29)30/h4-12H,1-3H3,(H,21,26) |
| InChIKey | RZRQPHLBLVAQEA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|