C24H26ClN5O4 — CID 1062109
N-[2-[[3-tert-butyl-1-(4-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-nitrobenzamide (PubChem CID 1062109) has the molecular formula C24H26ClN5O4 and a molecular weight of 483.96 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(4-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-nitrobenzamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(4-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 1062109 |
| Molecular Formula | C24H26ClN5O4 |
| Molecular Weight | 483.96 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(4-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-nitrobenzamide |
| SMILES | CCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccc(Cl)cc1)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H26ClN5O4/c1-5-28(23(32)16-6-10-19(11-7-16)30(33)34)15-22(31)26-21-14-20(24(2,3)4)27-29(21)18-12-8-17(25)9-13-18/h6-14H,5,15H2,1-4H3,(H,26,31) |
| InChIKey | LONPDZSHCIQYEA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.96 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|