C24H27N5O4 — CID 42733157
N-[2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl]-N-ethyl-3-nitrobenzamide (PubChem CID 42733157) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-[2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl]-N-ethyl-3-nitrobenzamide.
| Compound Name | N-[2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl]-N-ethyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 42733157 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | N-[2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl]-N-ethyl-3-nitrobenzamide |
| SMILES | CCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccccc1)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H27N5O4/c1-5-27(23(31)17-10-9-13-19(14-17)29(32)33)16-22(30)25-21-15-20(24(2,3)4)26-28(21)18-11-7-6-8-12-18/h6-15H,5,16H2,1-4H3,(H,25,30) |
| InChIKey | ZAAXXJUJLOAPPU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|