C25H28ClN5O5 — CID 3312662
N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-nitrobenzamide (PubChem CID 3312662) has the molecular formula C25H28ClN5O5 and a molecular weight of 513.98 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-nitrobenzamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 3312662 |
| Molecular Formula | C25H28ClN5O5 |
| Molecular Weight | 513.98 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-3-nitrobenzamide |
| SMILES | COCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccccc1Cl)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H28ClN5O5/c1-25(2,3)21-15-22(30(28-21)20-11-6-5-10-19(20)26)27-23(32)16-29(12-13-36-4)24(33)17-8-7-9-18(14-17)31(34)35/h5-11,14-15H,12-13,16H2,1-4H3,(H,27,32) |
| InChIKey | DYYCJHMXDALMFW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.98 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|