C25H28ClN5O4 — CID 42732137
N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-methyl-3-nitrobenzamide (PubChem CID 42732137) has the molecular formula C25H28ClN5O4 and a molecular weight of 497.98 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-methyl-3-nitrobenzamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 42732137 |
| Molecular Formula | C25H28ClN5O4 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-methyl-3-nitrobenzamide |
| SMILES | CCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccccc1Cl)C(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H28ClN5O4/c1-6-29(24(33)17-12-11-16(2)20(13-17)31(34)35)15-23(32)27-22-14-21(25(3,4)5)28-30(22)19-10-8-7-9-18(19)26/h7-14H,6,15H2,1-5H3,(H,27,32) |
| InChIKey | ISJAVDXKDOKNCT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|