C30H39ClN4O2 — CID 4019731
N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-hexylbenzamide (PubChem CID 4019731) has the molecular formula C30H39ClN4O2 and a molecular weight of 523.12 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-hexylbenzamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-hexylbenzamide |
|---|---|
| PubChem CID | 4019731 |
| Molecular Formula | C30H39ClN4O2 |
| Molecular Weight | 523.12 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-hexylbenzamide |
| SMILES | CCCCCCc1ccc(C(=O)N(CC)CC(=O)Nc2cc(C(C)(C)C)nn2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C30H39ClN4O2/c1-6-8-9-10-13-22-16-18-23(19-17-22)29(37)34(7-2)21-28(36)32-27-20-26(30(3,4)5)33-35(27)25-15-12-11-14-24(25)31/h11-12,14-20H,6-10,13,21H2,1-5H3,(H,32,36) |
| InChIKey | SSAIOGGQNVRJQL-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.12 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|