C20H20ClN5O3 — CID 42730474
1-[3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-yl]-3-(4-chlorophenyl)urea (PubChem CID 42730474) has the molecular formula C20H20ClN5O3 and a molecular weight of 413.87 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-yl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-yl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 42730474 |
| Molecular Formula | C20H20ClN5O3 |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 1-[3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-yl]-3-(4-chlorophenyl)urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(Cl)cc2)n(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C20H20ClN5O3/c1-20(2,3)17-12-18(23-19(27)22-14-6-4-13(21)5-7-14)25(24-17)15-8-10-16(11-9-15)26(28)29/h4-12H,1-3H3,(H2,22,23,27) |
| InChIKey | WRKXCERHZOBLOF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|