C27H30N6O3 — CID 142984002
1-[3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-yl]-3-[4-[(E)-4-ethenylimino-2-methylbut-2-enyl]phenyl]urea (PubChem CID 142984002) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-yl]-3-[4-[(E)-4-ethenylimino-2-methylbut-2-enyl]phenyl]urea.
| Compound Name | 1-[3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-yl]-3-[4-[(E)-4-ethenylimino-2-methylbut-2-enyl]phenyl]urea |
|---|---|
| PubChem CID | 142984002 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 1-[3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-yl]-3-[4-[(E)-4-ethenylimino-2-methylbut-2-enyl]phenyl]urea |
| SMILES | C=C/N=C/C=C(\C)Cc1ccc(NC(=O)Nc2cc(C(C)(C)C)nn2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H30N6O3/c1-6-28-16-15-19(2)17-20-7-9-21(10-8-20)29-26(34)30-25-18-24(27(3,4)5)31-32(25)22-11-13-23(14-12-22)33(35)36/h6-16,18H,1,17H2,2-5H3,(H2,29,30,34)/b19-15+,28-16+ |
| InChIKey | KDDGVYATOWVUHK-HIHYPLCCSA-N |
| XLogP | 6.43 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|