C23H22ClN5O — CID 58851249
1-(3-tert-butyl-1-quinolin-6-ylpyrazol-5-yl)-3-(4-chlorophenyl)urea (PubChem CID 58851249) has the molecular formula C23H22ClN5O and a molecular weight of 419.92 g/mol. Its IUPAC name is 1-(3-tert-butyl-1-quinolin-6-ylpyrazol-5-yl)-3-(4-chlorophenyl)urea.
| Compound Name | 1-(3-tert-butyl-1-quinolin-6-ylpyrazol-5-yl)-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 58851249 |
| Molecular Formula | C23H22ClN5O |
| Molecular Weight | 419.92 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-(3-tert-butyl-1-quinolin-6-ylpyrazol-5-yl)-3-(4-chlorophenyl)urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(Cl)cc2)n(-c2ccc3ncccc3c2)n1 |
| InChI | InChI=1S/C23H22ClN5O/c1-23(2,3)20-14-21(27-22(30)26-17-8-6-16(24)7-9-17)29(28-20)18-10-11-19-15(13-18)5-4-12-25-19/h4-14H,1-3H3,(H2,26,27,30) |
| InChIKey | FGXIQPZDXUWMQS-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.92 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |