About [1-(4-fluorophenyl)-3-propan-2-ylpyrazol-5-yl] 4-nitrobenzenesulfonate
[1-(4-fluorophenyl)-3-propan-2-ylpyrazol-5-yl] 4-nitrobenzenesulfonate (PubChem CID 42727037) has the molecular formula C18H16FN3O5S
and a molecular weight of 405.41 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-3-propan-2-ylpyrazol-5-yl] 4-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | [1-(4-fluorophenyl)-3-propan-2-ylpyrazol-5-yl] 4-nitrobenzenesulfonate |
| PubChem CID | 42727037 |
| Molecular Formula | C18H16FN3O5S |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | [1-(4-fluorophenyl)-3-propan-2-ylpyrazol-5-yl] 4-nitrobenzenesulfonate |
| SMILES | CC(C)c1cc(OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H16FN3O5S/c1-12(2)17-11-18(21(20-17)14-5-3-13(19)4-6-14)27-28(25,26)16-9-7-15(8-10-16)22(23)24/h3-12H,1-2H3 |
| InChIKey | PBMRPWYVBKDQRK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-fluorophenyl)-3-propan-2-ylpyrazol-5-yl] 4-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-fluorophenyl)-3-propan-2-ylpyrazol-5-yl] 4-nitrobenzenesulfonate?
The IUPAC name of [1-(4-fluorophenyl)-3-propan-2-ylpyrazol-5-yl] 4-nitrobenzenesulfonate (CID 42727037) is [1-(4-fluorophenyl)-3-propan-2-ylpyrazol-5-yl] 4-nitrobenzenesulfonate.
What is the SMILES notation for [1-(4-fluorophenyl)-3-propan-2-ylpyrazol-5-yl] 4-nitrobenzenesulfonate?
The canonical SMILES for [1-(4-fluorophenyl)-3-propan-2-ylpyrazol-5-yl] 4-nitrobenzenesulfonate is CC(C)c1cc(OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)n(-c2ccc(F)cc2)n1.
What is the InChIKey of [1-(4-fluorophenyl)-3-propan-2-ylpyrazol-5-yl] 4-nitrobenzenesulfonate?
The InChIKey is PBMRPWYVBKDQRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FN3O5S/c1-12(2)17-11-18(21(20-17)14-5-3-13(19)4-6-14)27-28(25,26)16-9-7-15(8-10-16)22(23)24/h3-12H,1-2H3.
What are the key properties of [1-(4-fluorophenyl)-3-propan-2-ylpyrazol-5-yl] 4-nitrobenzenesulfonate?
[1-(4-fluorophenyl)-3-propan-2-ylpyrazol-5-yl] 4-nitrobenzenesulfonate has a molecular weight of 405.41 g/mol, XLogP of 3.81, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-fluorophenyl)-3-propan-2-ylpyrazol-5-yl] 4-nitrobenzenesulfonate is sourced from PubChem (CID 42727037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).