C25H28FN5O6S — CID 98405073
N-[(2R)-butan-2-yl]-2-[1-(4-fluorophenyl)-4-methyl-3-(pyrrolidine-1-carbonyl)pyrazol-5-yl]oxy-5-nitrobenzenesulfonamide (PubChem CID 98405073) has the molecular formula C25H28FN5O6S and a molecular weight of 545.59 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-[1-(4-fluorophenyl)-4-methyl-3-(pyrrolidine-1-carbonyl)pyrazol-5-yl]oxy-5-nitrobenzenesulfonamide.
| Compound Name | N-[(2R)-butan-2-yl]-2-[1-(4-fluorophenyl)-4-methyl-3-(pyrrolidine-1-carbonyl)pyrazol-5-yl]oxy-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 98405073 |
| Molecular Formula | C25H28FN5O6S |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-[1-(4-fluorophenyl)-4-methyl-3-(pyrrolidine-1-carbonyl)pyrazol-5-yl]oxy-5-nitrobenzenesulfonamide |
| SMILES | CC[C@@H](C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)N2CCCC2)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H28FN5O6S/c1-4-16(2)28-38(35,36)22-15-20(31(33)34)11-12-21(22)37-25-17(3)23(24(32)29-13-5-6-14-29)27-30(25)19-9-7-18(26)8-10-19/h7-12,15-16,28H,4-6,13-14H2,1-3H3/t16-/m1/s1 |
| InChIKey | YSIWNVBBXJYGJD-MRXNPFEDSA-N |
| XLogP | 4.33 |
| TPSA | 136.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|