C25H30ClN5O6S — CID 83276573
5-[2-(butan-2-ylsulfamoyl)-4-nitrophenoxy]-1-(3-chlorophenyl)-4-methyl-N-(2-methylpropyl)pyrazole-3-carboxamide (PubChem CID 83276573) has the molecular formula C25H30ClN5O6S and a molecular weight of 564.06 g/mol. Its IUPAC name is 5-[2-(butan-2-ylsulfamoyl)-4-nitrophenoxy]-1-(3-chlorophenyl)-4-methyl-N-(2-methylpropyl)pyrazole-3-carboxamide.
| Compound Name | 5-[2-(butan-2-ylsulfamoyl)-4-nitrophenoxy]-1-(3-chlorophenyl)-4-methyl-N-(2-methylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83276573 |
| Molecular Formula | C25H30ClN5O6S |
| Molecular Weight | 564.06 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | 5-[2-(butan-2-ylsulfamoyl)-4-nitrophenoxy]-1-(3-chlorophenyl)-4-methyl-N-(2-methylpropyl)pyrazole-3-carboxamide |
| SMILES | CCC(C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)NCC(C)C)nn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H30ClN5O6S/c1-6-16(4)29-38(35,36)22-13-20(31(33)34)10-11-21(22)37-25-17(5)23(24(32)27-14-15(2)3)28-30(25)19-9-7-8-18(26)12-19/h7-13,15-16,29H,6,14H2,1-5H3,(H,27,32) |
| InChIKey | PLPBWVODEONIBD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.06 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|