C24H28ClN5O7S — CID 98444990
5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-(3-chlorophenyl)-N-(2-methoxyethyl)-4-methylpyrazole-3-carboxamide (PubChem CID 98444990) has the molecular formula C24H28ClN5O7S and a molecular weight of 566.04 g/mol. Its IUPAC name is 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-(3-chlorophenyl)-N-(2-methoxyethyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-(3-chlorophenyl)-N-(2-methoxyethyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 98444990 |
| Molecular Formula | C24H28ClN5O7S |
| Molecular Weight | 566.04 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-(3-chlorophenyl)-N-(2-methoxyethyl)-4-methylpyrazole-3-carboxamide |
| SMILES | CC[C@H](C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)NCCOC)nn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H28ClN5O7S/c1-5-15(2)28-38(34,35)21-14-19(30(32)33)9-10-20(21)37-24-16(3)22(23(31)26-11-12-36-4)27-29(24)18-8-6-7-17(25)13-18/h6-10,13-15,28H,5,11-12H2,1-4H3,(H,26,31)/t15-/m0/s1 |
| InChIKey | NQCDIRARXLUJSK-HNNXBMFYSA-N |
| XLogP | 3.99 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.04 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|