C22H33N5O7S — CID 97473385
5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-tert-butyl-N-(2-methoxyethyl)-4-methylpyrazole-3-carboxamide (PubChem CID 97473385) has the molecular formula C22H33N5O7S and a molecular weight of 511.60 g/mol. Its IUPAC name is 5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-tert-butyl-N-(2-methoxyethyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | 5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-tert-butyl-N-(2-methoxyethyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 97473385 |
| Molecular Formula | C22H33N5O7S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-tert-butyl-N-(2-methoxyethyl)-4-methylpyrazole-3-carboxamide |
| SMILES | CC[C@@H](C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)NCCOC)nn1C(C)(C)C |
| InChI | InChI=1S/C22H33N5O7S/c1-8-14(2)25-35(31,32)18-13-16(27(29)30)9-10-17(18)34-21-15(3)19(20(28)23-11-12-33-7)24-26(21)22(4,5)6/h9-10,13-14,25H,8,11-12H2,1-7H3,(H,23,28)/t14-/m1/s1 |
| InChIKey | HKHPYGHPRWORIB-CQSZACIVSA-N |
| XLogP | 3.10 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|