C21H31N5O6S — CID 91633454
N-butan-2-yl-5-[2-(butan-2-ylsulfamoyl)-4-nitrophenoxy]-1-ethyl-4-methylpyrazole-3-carboxamide (PubChem CID 91633454) has the molecular formula C21H31N5O6S and a molecular weight of 481.58 g/mol. Its IUPAC name is N-butan-2-yl-5-[2-(butan-2-ylsulfamoyl)-4-nitrophenoxy]-1-ethyl-4-methylpyrazole-3-carboxamide.
| Compound Name | N-butan-2-yl-5-[2-(butan-2-ylsulfamoyl)-4-nitrophenoxy]-1-ethyl-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 91633454 |
| Molecular Formula | C21H31N5O6S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | N-butan-2-yl-5-[2-(butan-2-ylsulfamoyl)-4-nitrophenoxy]-1-ethyl-4-methylpyrazole-3-carboxamide |
| SMILES | CCC(C)NC(=O)c1nn(CC)c(Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)NC(C)CC)c1C |
| InChI | InChI=1S/C21H31N5O6S/c1-7-13(4)22-20(27)19-15(6)21(25(9-3)23-19)32-17-11-10-16(26(28)29)12-18(17)33(30,31)24-14(5)8-2/h10-14,24H,7-9H2,1-6H3,(H,22,27) |
| InChIKey | OWAFMZQSWIGMPK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|