C21H29N5O7S — CID 97473461
1-ethyl-4-methyl-5-[4-nitro-2-(propan-2-ylsulfamoyl)phenoxy]-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-3-carboxamide (PubChem CID 97473461) has the molecular formula C21H29N5O7S and a molecular weight of 495.56 g/mol. Its IUPAC name is 1-ethyl-4-methyl-5-[4-nitro-2-(propan-2-ylsulfamoyl)phenoxy]-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-4-methyl-5-[4-nitro-2-(propan-2-ylsulfamoyl)phenoxy]-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 97473461 |
| Molecular Formula | C21H29N5O7S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 1-ethyl-4-methyl-5-[4-nitro-2-(propan-2-ylsulfamoyl)phenoxy]-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-3-carboxamide |
| SMILES | CCn1nc(C(=O)NC[C@H]2CCCO2)c(C)c1Oc1ccc([N+](=O)[O-])cc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C21H29N5O7S/c1-5-25-21(14(4)19(23-25)20(27)22-12-16-7-6-10-32-16)33-17-9-8-15(26(28)29)11-18(17)34(30,31)24-13(2)3/h8-9,11,13,16,24H,5-7,10,12H2,1-4H3,(H,22,27)/t16-/m1/s1 |
| InChIKey | BJADDGWMHBGQAP-MRXNPFEDSA-N |
| XLogP | 2.51 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|