C26H31N5O7S — CID 98441978
5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-4-methyl-N-[[(2R)-oxolan-2-yl]methyl]-1-phenylpyrazole-3-carboxamide (PubChem CID 98441978) has the molecular formula C26H31N5O7S and a molecular weight of 557.63 g/mol. Its IUPAC name is 5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-4-methyl-N-[[(2R)-oxolan-2-yl]methyl]-1-phenylpyrazole-3-carboxamide.
| Compound Name | 5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-4-methyl-N-[[(2R)-oxolan-2-yl]methyl]-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 98441978 |
| Molecular Formula | C26H31N5O7S |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | 5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-4-methyl-N-[[(2R)-oxolan-2-yl]methyl]-1-phenylpyrazole-3-carboxamide |
| SMILES | CC[C@@H](C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)NC[C@H]2CCCO2)nn1-c1ccccc1 |
| InChI | InChI=1S/C26H31N5O7S/c1-4-17(2)29-39(35,36)23-15-20(31(33)34)12-13-22(23)38-26-18(3)24(25(32)27-16-21-11-8-14-37-21)28-30(26)19-9-6-5-7-10-19/h5-7,9-10,12-13,15,17,21,29H,4,8,11,14,16H2,1-3H3,(H,27,32)/t17-,21-/m1/s1 |
| InChIKey | OAMFDSYQRXSHMI-DYESRHJHSA-N |
| XLogP | 3.87 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|