C26H30FN5O7S — CID 98440641
5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-(4-fluorophenyl)-4-methyl-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-3-carboxamide (PubChem CID 98440641) has the molecular formula C26H30FN5O7S and a molecular weight of 575.62 g/mol. Its IUPAC name is 5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-(4-fluorophenyl)-4-methyl-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-3-carboxamide.
| Compound Name | 5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-(4-fluorophenyl)-4-methyl-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 98440641 |
| Molecular Formula | C26H30FN5O7S |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | 5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-(4-fluorophenyl)-4-methyl-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-3-carboxamide |
| SMILES | CC[C@@H](C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)NC[C@H]2CCCO2)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H30FN5O7S/c1-4-16(2)30-40(36,37)23-14-20(32(34)35)11-12-22(23)39-26-17(3)24(25(33)28-15-21-6-5-13-38-21)29-31(26)19-9-7-18(27)8-10-19/h7-12,14,16,21,30H,4-6,13,15H2,1-3H3,(H,28,33)/t16-,21-/m1/s1 |
| InChIKey | HTWPLIGOAUCHDY-IIBYNOLFSA-N |
| XLogP | 4.01 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|